C10H11Cl3O2 — CID 54466422
2,2-dimethyl-3-(2,4,4-trichlorobuta-1,3-dienyl)cyclopropane-1-carboxylic acid (PubChem CID 54466422) has the molecular formula C10H11Cl3O2 and a molecular weight of 269.56 g/mol. Its IUPAC name is 2,2-dimethyl-3-(2,4,4-trichlorobuta-1,3-dienyl)cyclopropane-1-carboxylic acid.
| Compound Name | 2,2-dimethyl-3-(2,4,4-trichlorobuta-1,3-dienyl)cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 54466422 |
| Molecular Formula | C10H11Cl3O2 |
| Molecular Weight | 269.56 g/mol |
| Exact Mass | 267.98 |
| IUPAC Name | 2,2-dimethyl-3-(2,4,4-trichlorobuta-1,3-dienyl)cyclopropane-1-carboxylic acid |
| SMILES | CC1(C)C(C=C(Cl)C=C(Cl)Cl)C1C(=O)O |
| InChI | InChI=1S/C10H11Cl3O2/c1-10(2)6(8(10)9(14)15)3-5(11)4-7(12)13/h3-4,6,8H,1-2H3,(H,14,15) |
| InChIKey | XFENPJZAFYLVSM-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.56 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|