C16H26N4S2 — CID 54466621
2-[N,N'-bis(prop-2-enyl)carbamimidoyl]sulfanylethyl N,N'-bis(prop-2-enyl)carbamimidothioate (PubChem CID 54466621) has the molecular formula C16H26N4S2 and a molecular weight of 338.55 g/mol. Its IUPAC name is 2-[N,N'-bis(prop-2-enyl)carbamimidoyl]sulfanylethyl N,N'-bis(prop-2-enyl)carbamimidothioate.
| Compound Name | 2-[N,N'-bis(prop-2-enyl)carbamimidoyl]sulfanylethyl N,N'-bis(prop-2-enyl)carbamimidothioate |
|---|---|
| PubChem CID | 54466621 |
| Molecular Formula | C16H26N4S2 |
| Molecular Weight | 338.55 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 2-[N,N'-bis(prop-2-enyl)carbamimidoyl]sulfanylethyl N,N'-bis(prop-2-enyl)carbamimidothioate |
| SMILES | C=CC/N=C(/NCC=C)SCCS/C(=N/CC=C)NCC=C |
| InChI | InChI=1S/C16H26N4S2/c1-5-9-17-15(18-10-6-2)21-13-14-22-16(19-11-7-3)20-12-8-4/h5-8H,1-4,9-14H2,(H,17,18)(H,19,20) |
| InChIKey | XFIITSOLZBOPDD-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.55 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|