About [1,3-dimethyl-4-[2-methyl-3-(3-methylbut-2-en-2-yl)-4-methylsulfonylbenzoyl]pyrazol-5-yl] propanoate
[1,3-dimethyl-4-[2-methyl-3-(3-methylbut-2-en-2-yl)-4-methylsulfonylbenzoyl]pyrazol-5-yl] propanoate (PubChem CID 54466990) has the molecular formula C22H28N2O5S
and a molecular weight of 432.54 g/mol. Its IUPAC name is [1,3-dimethyl-4-[2-methyl-3-(3-methylbut-2-en-2-yl)-4-methylsulfonylbenzoyl]pyrazol-5-yl] propanoate.
Molecular Properties
| Compound Name | [1,3-dimethyl-4-[2-methyl-3-(3-methylbut-2-en-2-yl)-4-methylsulfonylbenzoyl]pyrazol-5-yl] propanoate |
| PubChem CID | 54466990 |
| Molecular Formula | C22H28N2O5S |
| Molecular Weight | 432.54 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | [1,3-dimethyl-4-[2-methyl-3-(3-methylbut-2-en-2-yl)-4-methylsulfonylbenzoyl]pyrazol-5-yl] propanoate |
| SMILES | CCC(=O)Oc1c(C(=O)c2ccc(S(C)(=O)=O)c(C(C)=C(C)C)c2C)c(C)nn1C |
| InChI | InChI=1S/C22H28N2O5S/c1-9-18(25)29-22-20(15(6)23-24(22)7)21(26)16-10-11-17(30(8,27)28)19(14(16)5)13(4)12(2)3/h10-11H,9H2,1-8H3 |
| InChIKey | XFOYKDQSNXPQNI-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 95.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 432.54 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [1,3-dimethyl-4-[2-methyl-3-(3-methylbut-2-en-2-yl)-4-methylsulfonylbenzoyl]pyrazol-5-yl] propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1,3-dimethyl-4-[2-methyl-3-(3-methylbut-2-en-2-yl)-4-methylsulfonylbenzoyl]pyrazol-5-yl] propanoate?
The IUPAC name of [1,3-dimethyl-4-[2-methyl-3-(3-methylbut-2-en-2-yl)-4-methylsulfonylbenzoyl]pyrazol-5-yl] propanoate (CID 54466990) is [1,3-dimethyl-4-[2-methyl-3-(3-methylbut-2-en-2-yl)-4-methylsulfonylbenzoyl]pyrazol-5-yl] propanoate.
What is the SMILES notation for [1,3-dimethyl-4-[2-methyl-3-(3-methylbut-2-en-2-yl)-4-methylsulfonylbenzoyl]pyrazol-5-yl] propanoate?
The canonical SMILES for [1,3-dimethyl-4-[2-methyl-3-(3-methylbut-2-en-2-yl)-4-methylsulfonylbenzoyl]pyrazol-5-yl] propanoate is CCC(=O)Oc1c(C(=O)c2ccc(S(C)(=O)=O)c(C(C)=C(C)C)c2C)c(C)nn1C.
What is the InChIKey of [1,3-dimethyl-4-[2-methyl-3-(3-methylbut-2-en-2-yl)-4-methylsulfonylbenzoyl]pyrazol-5-yl] propanoate?
The InChIKey is XFOYKDQSNXPQNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H28N2O5S/c1-9-18(25)29-22-20(15(6)23-24(22)7)21(26)16-10-11-17(30(8,27)28)19(14(16)5)13(4)12(2)3/h10-11H,9H2,1-8H3.
What are the key properties of [1,3-dimethyl-4-[2-methyl-3-(3-methylbut-2-en-2-yl)-4-methylsulfonylbenzoyl]pyrazol-5-yl] propanoate?
[1,3-dimethyl-4-[2-methyl-3-(3-methylbut-2-en-2-yl)-4-methylsulfonylbenzoyl]pyrazol-5-yl] propanoate has a molecular weight of 432.54 g/mol, XLogP of 3.80, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [1,3-dimethyl-4-[2-methyl-3-(3-methylbut-2-en-2-yl)-4-methylsulfonylbenzoyl]pyrazol-5-yl] propanoate is sourced from PubChem (CID 54466990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).