C22H31N3O2 — CID 54467381
(3R,6R)-3-[1-(1H-indol-3-yl)ethyl]-6-octylpiperazine-2,5-dione (PubChem CID 54467381) has the molecular formula C22H31N3O2 and a molecular weight of 369.51 g/mol. Its IUPAC name is (3R,6R)-3-[1-(1H-indol-3-yl)ethyl]-6-octylpiperazine-2,5-dione.
| Compound Name | (3R,6R)-3-[1-(1H-indol-3-yl)ethyl]-6-octylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 54467381 |
| Molecular Formula | C22H31N3O2 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.24 |
| IUPAC Name | (3R,6R)-3-[1-(1H-indol-3-yl)ethyl]-6-octylpiperazine-2,5-dione |
| SMILES | CCCCCCCC[C@H]1NC(=O)[C@@H](C(C)c2c[nH]c3ccccc23)NC1=O |
| InChI | InChI=1S/C22H31N3O2/c1-3-4-5-6-7-8-13-19-21(26)25-20(22(27)24-19)15(2)17-14-23-18-12-10-9-11-16(17)18/h9-12,14-15,19-20,23H,3-8,13H2,1-2H3,(H,24,27)(H,25,26)/t15?,19-,20-/m1/s1 |
| InChIKey | XFWLCUKQBATTLV-YUZWYKEKSA-N |
| XLogP | 4.01 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|