About 4-nitroso-4H-pyrrolo[1,2-a]indole
4-nitroso-4H-pyrrolo[1,2-a]indole (PubChem CID 54467640) has the molecular formula C11H8N2O
and a molecular weight of 184.20 g/mol. Its IUPAC name is 4-nitroso-4H-pyrrolo[1,2-a]indole.
Molecular Properties
| Compound Name | 4-nitroso-4H-pyrrolo[1,2-a]indole |
| PubChem CID | 54467640 |
| Molecular Formula | C11H8N2O |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.06 |
| IUPAC Name | 4-nitroso-4H-pyrrolo[1,2-a]indole |
| SMILES | O=NC1c2ccccc2-n2cccc21 |
| InChI | InChI=1S/C11H8N2O/c14-12-11-8-4-1-2-5-9(8)13-7-3-6-10(11)13/h1-7,11H |
| InChIKey | XGBJFKKPNPZQNL-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-nitroso-4H-pyrrolo[1,2-a]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-nitroso-4H-pyrrolo[1,2-a]indole?
The IUPAC name of 4-nitroso-4H-pyrrolo[1,2-a]indole (CID 54467640) is 4-nitroso-4H-pyrrolo[1,2-a]indole.
What is the SMILES notation for 4-nitroso-4H-pyrrolo[1,2-a]indole?
The canonical SMILES for 4-nitroso-4H-pyrrolo[1,2-a]indole is O=NC1c2ccccc2-n2cccc21.
What is the InChIKey of 4-nitroso-4H-pyrrolo[1,2-a]indole?
The InChIKey is XGBJFKKPNPZQNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N2O/c14-12-11-8-4-1-2-5-9(8)13-7-3-6-10(11)13/h1-7,11H.
What are the key properties of 4-nitroso-4H-pyrrolo[1,2-a]indole?
4-nitroso-4H-pyrrolo[1,2-a]indole has a molecular weight of 184.20 g/mol, XLogP of 2.65, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-nitroso-4H-pyrrolo[1,2-a]indole is sourced from PubChem (CID 54467640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).