C28H20Cl4F2O4 — CID 54467960
1,2-bis(2,4-dichlorophenyl)-1,2-bis(2-fluoro-4-methoxyphenyl)ethane-1,2-diol (PubChem CID 54467960) has the molecular formula C28H20Cl4F2O4 and a molecular weight of 600.27 g/mol. Its IUPAC name is 1,2-bis(2,4-dichlorophenyl)-1,2-bis(2-fluoro-4-methoxyphenyl)ethane-1,2-diol.
| Compound Name | 1,2-bis(2,4-dichlorophenyl)-1,2-bis(2-fluoro-4-methoxyphenyl)ethane-1,2-diol |
|---|---|
| PubChem CID | 54467960 |
| Molecular Formula | C28H20Cl4F2O4 |
| Molecular Weight | 600.27 g/mol |
| Exact Mass | 598.01 |
| IUPAC Name | 1,2-bis(2,4-dichlorophenyl)-1,2-bis(2-fluoro-4-methoxyphenyl)ethane-1,2-diol |
| SMILES | COc1ccc(C(O)(c2ccc(Cl)cc2Cl)C(O)(c2ccc(OC)cc2F)c2ccc(Cl)cc2Cl)c(F)c1 |
| InChI | InChI=1S/C28H20Cl4F2O4/c1-37-17-5-9-21(25(33)13-17)27(35,19-7-3-15(29)11-23(19)31)28(36,20-8-4-16(30)12-24(20)32)22-10-6-18(38-2)14-26(22)34/h3-14,35-36H,1-2H3 |
| InChIKey | XGHLIEDFONYRIE-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.27 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |