About cyclopropylcyclooctane
cyclopropylcyclooctane (PubChem CID 54468251) has the molecular formula C11H20
and a molecular weight of 152.28 g/mol. Its IUPAC name is cyclopropylcyclooctane.
Molecular Properties
| Compound Name | cyclopropylcyclooctane |
| PubChem CID | 54468251 |
| Molecular Formula | C11H20 |
| Molecular Weight | 152.28 g/mol |
| Exact Mass | 152.16 |
| IUPAC Name | cyclopropylcyclooctane |
| SMILES | C1CCCC(C2CC2)CCC1 |
| InChI | InChI=1S/C11H20/c1-2-4-6-10(7-5-3-1)11-8-9-11/h10-11H,1-9H2 |
| InChIKey | DZEWQZKSAYNDQC-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.28 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze cyclopropylcyclooctane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropylcyclooctane?
The IUPAC name of cyclopropylcyclooctane (CID 54468251) is cyclopropylcyclooctane.
What is the SMILES notation for cyclopropylcyclooctane?
The canonical SMILES for cyclopropylcyclooctane is C1CCCC(C2CC2)CCC1.
What is the InChIKey of cyclopropylcyclooctane?
The InChIKey is DZEWQZKSAYNDQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20/c1-2-4-6-10(7-5-3-1)11-8-9-11/h10-11H,1-9H2.
What are the key properties of cyclopropylcyclooctane?
cyclopropylcyclooctane has a molecular weight of 152.28 g/mol, XLogP of 3.76, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropylcyclooctane is sourced from PubChem (CID 54468251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).