C13H16N2O — CID 54468429
6,7,8,9,10,12-hexahydroazepino[2,1-b]quinazolin-12-ol (PubChem CID 54468429) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is 6,7,8,9,10,12-hexahydroazepino[2,1-b]quinazolin-12-ol.
| Compound Name | 6,7,8,9,10,12-hexahydroazepino[2,1-b]quinazolin-12-ol |
|---|---|
| PubChem CID | 54468429 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 6,7,8,9,10,12-hexahydroazepino[2,1-b]quinazolin-12-ol |
| SMILES | OC1c2ccccc2N=C2CCCCCN21 |
| InChI | InChI=1S/C13H16N2O/c16-13-10-6-3-4-7-11(10)14-12-8-2-1-5-9-15(12)13/h3-4,6-7,13,16H,1-2,5,8-9H2 |
| InChIKey | XGPIUJUIVKHCMU-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |