C19H14F3N — CID 54468686
7-azulen-1-yl-8,8,8-trifluoro-3-methylocta-2,4,6-trienenitrile (PubChem CID 54468686) has the molecular formula C19H14F3N and a molecular weight of 313.32 g/mol. Its IUPAC name is 7-azulen-1-yl-8,8,8-trifluoro-3-methylocta-2,4,6-trienenitrile.
| Compound Name | 7-azulen-1-yl-8,8,8-trifluoro-3-methylocta-2,4,6-trienenitrile |
|---|---|
| PubChem CID | 54468686 |
| Molecular Formula | C19H14F3N |
| Molecular Weight | 313.32 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 7-azulen-1-yl-8,8,8-trifluoro-3-methylocta-2,4,6-trienenitrile |
| SMILES | CC(C=CC=C(c1ccc2cccccc1-2)C(F)(F)F)=CC#N |
| InChI | InChI=1S/C19H14F3N/c1-14(12-13-23)6-5-9-18(19(20,21)22)17-11-10-15-7-3-2-4-8-16(15)17/h2-12H,1H3 |
| InChIKey | XGTRKKZZYHKSKL-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.32 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|