About 1,2,4-trifluorohexane
1,2,4-trifluorohexane (PubChem CID 54469052) has the molecular formula C6H11F3
and a molecular weight of 140.15 g/mol. Its IUPAC name is 1,2,4-trifluorohexane.
Molecular Properties
| Compound Name | 1,2,4-trifluorohexane |
| PubChem CID | 54469052 |
| Molecular Formula | C6H11F3 |
| Molecular Weight | 140.15 g/mol |
| Exact Mass | 140.08 |
| IUPAC Name | 1,2,4-trifluorohexane |
| SMILES | CCC(F)CC(F)CF |
| InChI | InChI=1S/C6H11F3/c1-2-5(8)3-6(9)4-7/h5-6H,2-4H2,1H3 |
| InChIKey | HGNNWODYLWZYBI-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.15 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,2,4-trifluorohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,4-trifluorohexane?
The IUPAC name of 1,2,4-trifluorohexane (CID 54469052) is 1,2,4-trifluorohexane.
What is the SMILES notation for 1,2,4-trifluorohexane?
The canonical SMILES for 1,2,4-trifluorohexane is CCC(F)CC(F)CF.
What is the InChIKey of 1,2,4-trifluorohexane?
The InChIKey is HGNNWODYLWZYBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11F3/c1-2-5(8)3-6(9)4-7/h5-6H,2-4H2,1H3.
What are the key properties of 1,2,4-trifluorohexane?
1,2,4-trifluorohexane has a molecular weight of 140.15 g/mol, XLogP of 2.43, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,4-trifluorohexane is sourced from PubChem (CID 54469052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).