About 2-formylpentanedinitrile
2-formylpentanedinitrile (PubChem CID 54469175) has the molecular formula C6H6N2O
and a molecular weight of 122.13 g/mol. Its IUPAC name is 2-formylpentanedinitrile.
Molecular Properties
| Compound Name | 2-formylpentanedinitrile |
| PubChem CID | 54469175 |
| Molecular Formula | C6H6N2O |
| Molecular Weight | 122.13 g/mol |
| Exact Mass | 122.05 |
| IUPAC Name | 2-formylpentanedinitrile |
| SMILES | N#CCCC(C#N)C=O |
| InChI | InChI=1S/C6H6N2O/c7-3-1-2-6(4-8)5-9/h5-6H,1-2H2 |
| InChIKey | XHBUQWXMQRGQHU-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 64.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.13 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-formylpentanedinitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-formylpentanedinitrile?
The IUPAC name of 2-formylpentanedinitrile (CID 54469175) is 2-formylpentanedinitrile.
What is the SMILES notation for 2-formylpentanedinitrile?
The canonical SMILES for 2-formylpentanedinitrile is N#CCCC(C#N)C=O.
What is the InChIKey of 2-formylpentanedinitrile?
The InChIKey is XHBUQWXMQRGQHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2O/c7-3-1-2-6(4-8)5-9/h5-6H,1-2H2.
What are the key properties of 2-formylpentanedinitrile?
2-formylpentanedinitrile has a molecular weight of 122.13 g/mol, XLogP of 0.63, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-formylpentanedinitrile is sourced from PubChem (CID 54469175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).