C12H19NO5S — CID 54469246
(2S,4S)-1-(4-acetylsulfanylbutanoyl)-4-methoxypyrrolidine-2-carboxylic acid (PubChem CID 54469246) has the molecular formula C12H19NO5S and a molecular weight of 289.35 g/mol. Its IUPAC name is (2S,4S)-1-(4-acetylsulfanylbutanoyl)-4-methoxypyrrolidine-2-carboxylic acid.
| Compound Name | (2S,4S)-1-(4-acetylsulfanylbutanoyl)-4-methoxypyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 54469246 |
| Molecular Formula | C12H19NO5S |
| Molecular Weight | 289.35 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | (2S,4S)-1-(4-acetylsulfanylbutanoyl)-4-methoxypyrrolidine-2-carboxylic acid |
| SMILES | CO[C@H]1C[C@@H](C(=O)O)N(C(=O)CCCSC(C)=O)C1 |
| InChI | InChI=1S/C12H19NO5S/c1-8(14)19-5-3-4-11(15)13-7-9(18-2)6-10(13)12(16)17/h9-10H,3-7H2,1-2H3,(H,16,17)/t9-,10-/m0/s1 |
| InChIKey | XHDCBSMEXBEFIP-UWVGGRQHSA-N |
| XLogP | 0.75 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.35 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|