C14H10ClFN2 — CID 54469755
2-[(2-chloro-4-fluorophenyl)methyl]-1H-benzimidazole (PubChem CID 54469755) has the molecular formula C14H10ClFN2 and a molecular weight of 260.70 g/mol. Its IUPAC name is 2-[(2-chloro-4-fluorophenyl)methyl]-1H-benzimidazole.
| Compound Name | 2-[(2-chloro-4-fluorophenyl)methyl]-1H-benzimidazole |
|---|---|
| PubChem CID | 54469755 |
| Molecular Formula | C14H10ClFN2 |
| Molecular Weight | 260.70 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | 2-[(2-chloro-4-fluorophenyl)methyl]-1H-benzimidazole |
| SMILES | Fc1ccc(Cc2nc3ccccc3[nH]2)c(Cl)c1 |
| InChI | InChI=1S/C14H10ClFN2/c15-11-8-10(16)6-5-9(11)7-14-17-12-3-1-2-4-13(12)18-14/h1-6,8H,7H2,(H,17,18) |
| InChIKey | XHMBLVKRROTVCG-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.70 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |