About 1-purin-9-ylpropan-2-one
1-purin-9-ylpropan-2-one (PubChem CID 54470109) has the molecular formula C8H8N4O
and a molecular weight of 176.18 g/mol. Its IUPAC name is 1-purin-9-ylpropan-2-one.
Molecular Properties
| Compound Name | 1-purin-9-ylpropan-2-one |
| PubChem CID | 54470109 |
| Molecular Formula | C8H8N4O |
| Molecular Weight | 176.18 g/mol |
| Exact Mass | 176.07 |
| IUPAC Name | 1-purin-9-ylpropan-2-one |
| SMILES | CC(=O)Cn1cnc2cncnc21 |
| InChI | InChI=1S/C8H8N4O/c1-6(13)3-12-5-11-7-2-9-4-10-8(7)12/h2,4-5H,3H2,1H3 |
| InChIKey | XHSVJKZLUMPOJY-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.18 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-purin-9-ylpropan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-purin-9-ylpropan-2-one?
The IUPAC name of 1-purin-9-ylpropan-2-one (CID 54470109) is 1-purin-9-ylpropan-2-one.
What is the SMILES notation for 1-purin-9-ylpropan-2-one?
The canonical SMILES for 1-purin-9-ylpropan-2-one is CC(=O)Cn1cnc2cncnc21.
What is the InChIKey of 1-purin-9-ylpropan-2-one?
The InChIKey is XHSVJKZLUMPOJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N4O/c1-6(13)3-12-5-11-7-2-9-4-10-8(7)12/h2,4-5H,3H2,1H3.
What are the key properties of 1-purin-9-ylpropan-2-one?
1-purin-9-ylpropan-2-one has a molecular weight of 176.18 g/mol, XLogP of 0.42, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-purin-9-ylpropan-2-one is sourced from PubChem (CID 54470109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).