C17H30BN7O4 — CID 54470115
N-[N'-[[5-[3-[ethanimidoyl(methyl)amino]propyl]-1-methyl-3,7-dioxo-1,4-diazepan-2-yl]methyl]-N-(oxoboranylmethyl)carbamimidoyl]acetamide (PubChem CID 54470115) has the molecular formula C17H30BN7O4 and a molecular weight of 407.28 g/mol. Its IUPAC name is N-[N'-[[5-[3-[ethanimidoyl(methyl)amino]propyl]-1-methyl-3,7-dioxo-1,4-diazepan-2-yl]methyl]-N-(oxoboranylmethyl)carbamimidoyl]acetamide.
| Compound Name | N-[N'-[[5-[3-[ethanimidoyl(methyl)amino]propyl]-1-methyl-3,7-dioxo-1,4-diazepan-2-yl]methyl]-N-(oxoboranylmethyl)carbamimidoyl]acetamide |
|---|---|
| PubChem CID | 54470115 |
| Molecular Formula | C17H30BN7O4 |
| Molecular Weight | 407.28 g/mol |
| Exact Mass | 407.25 |
| IUPAC Name | N-[N'-[[5-[3-[ethanimidoyl(methyl)amino]propyl]-1-methyl-3,7-dioxo-1,4-diazepan-2-yl]methyl]-N-(oxoboranylmethyl)carbamimidoyl]acetamide |
| SMILES | [H]/N=C(\C)N(C)CCCC1CC(=O)N(C)C(C/N=C(\NCB=O)NC(C)=O)C(=O)N1 |
| InChI | InChI=1S/C17H30BN7O4/c1-11(19)24(3)7-5-6-13-8-15(27)25(4)14(16(28)23-13)9-20-17(21-10-18-29)22-12(2)26/h13-14,19H,5-10H2,1-4H3,(H,23,28)(H2,20,21,22,26)/b19-11+ |
| InChIKey | XHSXNHDLDVEDPE-YBFXNURJSA-N |
| XLogP | -1.50 |
| TPSA | 147.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.28 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|