About 1-(1H-imidazol-5-yl)-1-(4-methylthiophen-2-yl)-2,2,2-triphenylethanol
1-(1H-imidazol-5-yl)-1-(4-methylthiophen-2-yl)-2,2,2-triphenylethanol (PubChem CID 54470267) has the molecular formula C28H24N2OS
and a molecular weight of 436.58 g/mol. Its IUPAC name is 1-(1H-imidazol-5-yl)-1-(4-methylthiophen-2-yl)-2,2,2-triphenylethanol.
Molecular Properties
| Compound Name | 1-(1H-imidazol-5-yl)-1-(4-methylthiophen-2-yl)-2,2,2-triphenylethanol |
| PubChem CID | 54470267 |
| Molecular Formula | C28H24N2OS |
| Molecular Weight | 436.58 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | 1-(1H-imidazol-5-yl)-1-(4-methylthiophen-2-yl)-2,2,2-triphenylethanol |
| SMILES | Cc1csc(C(O)(c2cnc[nH]2)C(c2ccccc2)(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C28H24N2OS/c1-21-17-26(32-19-21)28(31,25-18-29-20-30-25)27(22-11-5-2-6-12-22,23-13-7-3-8-14-23)24-15-9-4-10-16-24/h2-20,31H,1H3,(H,29,30) |
| InChIKey | XHVKBOFIQRYBDA-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 436.58 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze 1-(1H-imidazol-5-yl)-1-(4-methylthiophen-2-yl)-2,2,2-triphenylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1H-imidazol-5-yl)-1-(4-methylthiophen-2-yl)-2,2,2-triphenylethanol?
The IUPAC name of 1-(1H-imidazol-5-yl)-1-(4-methylthiophen-2-yl)-2,2,2-triphenylethanol (CID 54470267) is 1-(1H-imidazol-5-yl)-1-(4-methylthiophen-2-yl)-2,2,2-triphenylethanol.
What is the SMILES notation for 1-(1H-imidazol-5-yl)-1-(4-methylthiophen-2-yl)-2,2,2-triphenylethanol?
The canonical SMILES for 1-(1H-imidazol-5-yl)-1-(4-methylthiophen-2-yl)-2,2,2-triphenylethanol is Cc1csc(C(O)(c2cnc[nH]2)C(c2ccccc2)(c2ccccc2)c2ccccc2)c1.
What is the InChIKey of 1-(1H-imidazol-5-yl)-1-(4-methylthiophen-2-yl)-2,2,2-triphenylethanol?
The InChIKey is XHVKBOFIQRYBDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H24N2OS/c1-21-17-26(32-19-21)28(31,25-18-29-20-30-25)27(22-11-5-2-6-12-22,23-13-7-3-8-14-23)24-15-9-4-10-16-24/h2-20,31H,1H3,(H,29,30).
What are the key properties of 1-(1H-imidazol-5-yl)-1-(4-methylthiophen-2-yl)-2,2,2-triphenylethanol?
1-(1H-imidazol-5-yl)-1-(4-methylthiophen-2-yl)-2,2,2-triphenylethanol has a molecular weight of 436.58 g/mol, XLogP of 6.05, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1H-imidazol-5-yl)-1-(4-methylthiophen-2-yl)-2,2,2-triphenylethanol is sourced from PubChem (CID 54470267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).