C13H17NO2 — CID 54470530
2,3,4,4a,5,6,7,8a,10,10a-decahydroacridine-1,8-dione (PubChem CID 54470530) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is 2,3,4,4a,5,6,7,8a,10,10a-decahydroacridine-1,8-dione.
| Compound Name | 2,3,4,4a,5,6,7,8a,10,10a-decahydroacridine-1,8-dione |
|---|---|
| PubChem CID | 54470530 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 2,3,4,4a,5,6,7,8a,10,10a-decahydroacridine-1,8-dione |
| SMILES | O=C1CCCC2NC3CCCC(=O)C3C=C12 |
| InChI | InChI=1S/C13H17NO2/c15-12-5-1-3-10-8(12)7-9-11(14-10)4-2-6-13(9)16/h7-8,10-11,14H,1-6H2 |
| InChIKey | XIAKEGRVDSZHMH-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |