About 1-ethyl-2,5-bis(2-methoxyphenyl)-1-methyl-3,4-diphenylsilole
1-ethyl-2,5-bis(2-methoxyphenyl)-1-methyl-3,4-diphenylsilole (PubChem CID 54471201) has the molecular formula C33H32O2Si
and a molecular weight of 488.70 g/mol. Its IUPAC name is 1-ethyl-2,5-bis(2-methoxyphenyl)-1-methyl-3,4-diphenylsilole.
Molecular Properties
| Compound Name | 1-ethyl-2,5-bis(2-methoxyphenyl)-1-methyl-3,4-diphenylsilole |
| PubChem CID | 54471201 |
| Molecular Formula | C33H32O2Si |
| Molecular Weight | 488.70 g/mol |
| Exact Mass | 488.22 |
| IUPAC Name | 1-ethyl-2,5-bis(2-methoxyphenyl)-1-methyl-3,4-diphenylsilole |
| SMILES | CC[Si]1(C)C(c2ccccc2OC)=C(c2ccccc2)C(c2ccccc2)=C1c1ccccc1OC |
| InChI | InChI=1S/C33H32O2Si/c1-5-36(4)32(26-20-12-14-22-28(26)34-2)30(24-16-8-6-9-17-24)31(25-18-10-7-11-19-25)33(36)27-21-13-15-23-29(27)35-3/h6-23H,5H2,1-4H3 |
| InChIKey | XIMJWDQOWFBJFY-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 488.70 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-2,5-bis(2-methoxyphenyl)-1-methyl-3,4-diphenylsilole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-2,5-bis(2-methoxyphenyl)-1-methyl-3,4-diphenylsilole?
The IUPAC name of 1-ethyl-2,5-bis(2-methoxyphenyl)-1-methyl-3,4-diphenylsilole (CID 54471201) is 1-ethyl-2,5-bis(2-methoxyphenyl)-1-methyl-3,4-diphenylsilole.
What is the SMILES notation for 1-ethyl-2,5-bis(2-methoxyphenyl)-1-methyl-3,4-diphenylsilole?
The canonical SMILES for 1-ethyl-2,5-bis(2-methoxyphenyl)-1-methyl-3,4-diphenylsilole is CC[Si]1(C)C(c2ccccc2OC)=C(c2ccccc2)C(c2ccccc2)=C1c1ccccc1OC.
What is the InChIKey of 1-ethyl-2,5-bis(2-methoxyphenyl)-1-methyl-3,4-diphenylsilole?
The InChIKey is XIMJWDQOWFBJFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H32O2Si/c1-5-36(4)32(26-20-12-14-22-28(26)34-2)30(24-16-8-6-9-17-24)31(25-18-10-7-11-19-25)33(36)27-21-13-15-23-29(27)35-3/h6-23H,5H2,1-4H3.
What are the key properties of 1-ethyl-2,5-bis(2-methoxyphenyl)-1-methyl-3,4-diphenylsilole?
1-ethyl-2,5-bis(2-methoxyphenyl)-1-methyl-3,4-diphenylsilole has a molecular weight of 488.70 g/mol, XLogP of 8.42, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-2,5-bis(2-methoxyphenyl)-1-methyl-3,4-diphenylsilole is sourced from PubChem (CID 54471201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).