C16H19N5O2 — CID 54471737
1-carbamimidoyl-3-(2-phenylmethoxyethyl)-1-pyridin-3-ylurea (PubChem CID 54471737) has the molecular formula C16H19N5O2 and a molecular weight of 313.36 g/mol. Its IUPAC name is 1-carbamimidoyl-3-(2-phenylmethoxyethyl)-1-pyridin-3-ylurea.
| Compound Name | 1-carbamimidoyl-3-(2-phenylmethoxyethyl)-1-pyridin-3-ylurea |
|---|---|
| PubChem CID | 54471737 |
| Molecular Formula | C16H19N5O2 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 1-carbamimidoyl-3-(2-phenylmethoxyethyl)-1-pyridin-3-ylurea |
| SMILES | [H]/N=C(\N)N(C(=O)NCCOCc1ccccc1)c1cccnc1 |
| InChI | InChI=1S/C16H19N5O2/c17-15(18)21(14-7-4-8-19-11-14)16(22)20-9-10-23-12-13-5-2-1-3-6-13/h1-8,11H,9-10,12H2,(H3,17,18)(H,20,22) |
| InChIKey | XIVBNRWHEUZJNB-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 104.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|