About (2S)-N-[(3S)-2-amino-1-cyclohexyl-3-hydroxybutyl]-2,6-dimethylheptanamide
(2S)-N-[(3S)-2-amino-1-cyclohexyl-3-hydroxybutyl]-2,6-dimethylheptanamide (PubChem CID 54472012) has the molecular formula C19H38N2O2
and a molecular weight of 326.53 g/mol. Its IUPAC name is (2S)-N-[(3S)-2-amino-1-cyclohexyl-3-hydroxybutyl]-2,6-dimethylheptanamide.
Molecular Properties
| Compound Name | (2S)-N-[(3S)-2-amino-1-cyclohexyl-3-hydroxybutyl]-2,6-dimethylheptanamide |
| PubChem CID | 54472012 |
| Molecular Formula | C19H38N2O2 |
| Molecular Weight | 326.53 g/mol |
| Exact Mass | 326.29 |
| IUPAC Name | (2S)-N-[(3S)-2-amino-1-cyclohexyl-3-hydroxybutyl]-2,6-dimethylheptanamide |
| SMILES | CC(C)CCC[C@H](C)C(=O)NC(C1CCCCC1)C(N)[C@H](C)O |
| InChI | InChI=1S/C19H38N2O2/c1-13(2)9-8-10-14(3)19(23)21-18(17(20)15(4)22)16-11-6-5-7-12-16/h13-18,22H,5-12,20H2,1-4H3,(H,21,23)/t14-,15-,17?,18?/m0/s1 |
| InChIKey | XIZWVIMHBGTYRW-QEFXCSQDSA-N |
| XLogP | 3.22 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.53 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-N-[(3S)-2-amino-1-cyclohexyl-3-hydroxybutyl]-2,6-dimethylheptanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-N-[(3S)-2-amino-1-cyclohexyl-3-hydroxybutyl]-2,6-dimethylheptanamide?
The IUPAC name of (2S)-N-[(3S)-2-amino-1-cyclohexyl-3-hydroxybutyl]-2,6-dimethylheptanamide (CID 54472012) is (2S)-N-[(3S)-2-amino-1-cyclohexyl-3-hydroxybutyl]-2,6-dimethylheptanamide.
What is the SMILES notation for (2S)-N-[(3S)-2-amino-1-cyclohexyl-3-hydroxybutyl]-2,6-dimethylheptanamide?
The canonical SMILES for (2S)-N-[(3S)-2-amino-1-cyclohexyl-3-hydroxybutyl]-2,6-dimethylheptanamide is CC(C)CCC[C@H](C)C(=O)NC(C1CCCCC1)C(N)[C@H](C)O.
What is the InChIKey of (2S)-N-[(3S)-2-amino-1-cyclohexyl-3-hydroxybutyl]-2,6-dimethylheptanamide?
The InChIKey is XIZWVIMHBGTYRW-QEFXCSQDSA-N. The full InChI is InChI=1S/C19H38N2O2/c1-13(2)9-8-10-14(3)19(23)21-18(17(20)15(4)22)16-11-6-5-7-12-16/h13-18,22H,5-12,20H2,1-4H3,(H,21,23)/t14-,15-,17?,18?/m0/s1.
What are the key properties of (2S)-N-[(3S)-2-amino-1-cyclohexyl-3-hydroxybutyl]-2,6-dimethylheptanamide?
(2S)-N-[(3S)-2-amino-1-cyclohexyl-3-hydroxybutyl]-2,6-dimethylheptanamide has a molecular weight of 326.53 g/mol, XLogP of 3.22, 9 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-N-[(3S)-2-amino-1-cyclohexyl-3-hydroxybutyl]-2,6-dimethylheptanamide is sourced from PubChem (CID 54472012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).