About 4-bromo-1,2,3-trifluoro-5-(4-methoxyphenyl)sulfonylbenzene
4-bromo-1,2,3-trifluoro-5-(4-methoxyphenyl)sulfonylbenzene (PubChem CID 54472260) has the molecular formula C13H8BrF3O3S
and a molecular weight of 381.17 g/mol. Its IUPAC name is 4-bromo-1,2,3-trifluoro-5-(4-methoxyphenyl)sulfonylbenzene.
Molecular Properties
| Compound Name | 4-bromo-1,2,3-trifluoro-5-(4-methoxyphenyl)sulfonylbenzene |
| PubChem CID | 54472260 |
| Molecular Formula | C13H8BrF3O3S |
| Molecular Weight | 381.17 g/mol |
| Exact Mass | 379.93 |
| IUPAC Name | 4-bromo-1,2,3-trifluoro-5-(4-methoxyphenyl)sulfonylbenzene |
| SMILES | COc1ccc(S(=O)(=O)c2cc(F)c(F)c(F)c2Br)cc1 |
| InChI | InChI=1S/C13H8BrF3O3S/c1-20-7-2-4-8(5-3-7)21(18,19)10-6-9(15)12(16)13(17)11(10)14/h2-6H,1H3 |
| InChIKey | XJDYBVYBLLIAJV-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.17 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-1,2,3-trifluoro-5-(4-methoxyphenyl)sulfonylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-1,2,3-trifluoro-5-(4-methoxyphenyl)sulfonylbenzene?
The IUPAC name of 4-bromo-1,2,3-trifluoro-5-(4-methoxyphenyl)sulfonylbenzene (CID 54472260) is 4-bromo-1,2,3-trifluoro-5-(4-methoxyphenyl)sulfonylbenzene.
What is the SMILES notation for 4-bromo-1,2,3-trifluoro-5-(4-methoxyphenyl)sulfonylbenzene?
The canonical SMILES for 4-bromo-1,2,3-trifluoro-5-(4-methoxyphenyl)sulfonylbenzene is COc1ccc(S(=O)(=O)c2cc(F)c(F)c(F)c2Br)cc1.
What is the InChIKey of 4-bromo-1,2,3-trifluoro-5-(4-methoxyphenyl)sulfonylbenzene?
The InChIKey is XJDYBVYBLLIAJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8BrF3O3S/c1-20-7-2-4-8(5-3-7)21(18,19)10-6-9(15)12(16)13(17)11(10)14/h2-6H,1H3.
What are the key properties of 4-bromo-1,2,3-trifluoro-5-(4-methoxyphenyl)sulfonylbenzene?
4-bromo-1,2,3-trifluoro-5-(4-methoxyphenyl)sulfonylbenzene has a molecular weight of 381.17 g/mol, XLogP of 3.71, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-1,2,3-trifluoro-5-(4-methoxyphenyl)sulfonylbenzene is sourced from PubChem (CID 54472260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).