C15H9N5O2S — CID 54472497
2-[5-(6-methyl-2-oxo-3,6-dihydro-1,3,4-thiadiazin-5-yl)-2-oxo-1H-indol-3-ylidene]propanedinitrile (PubChem CID 54472497) has the molecular formula C15H9N5O2S and a molecular weight of 323.34 g/mol. Its IUPAC name is 2-[5-(6-methyl-2-oxo-3,6-dihydro-1,3,4-thiadiazin-5-yl)-2-oxo-1H-indol-3-ylidene]propanedinitrile.
| Compound Name | 2-[5-(6-methyl-2-oxo-3,6-dihydro-1,3,4-thiadiazin-5-yl)-2-oxo-1H-indol-3-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 54472497 |
| Molecular Formula | C15H9N5O2S |
| Molecular Weight | 323.34 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | 2-[5-(6-methyl-2-oxo-3,6-dihydro-1,3,4-thiadiazin-5-yl)-2-oxo-1H-indol-3-ylidene]propanedinitrile |
| SMILES | CC1SC(=O)NN=C1c1ccc2c(c1)C(=C(C#N)C#N)C(=O)N2 |
| InChI | InChI=1S/C15H9N5O2S/c1-7-13(19-20-15(22)23-7)8-2-3-11-10(4-8)12(14(21)18-11)9(5-16)6-17/h2-4,7H,1H3,(H,18,21)(H,20,22) |
| InChIKey | XJHMKLVPGFMNHU-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 118.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.34 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|