C10H18O4 — CID 544726
2,3,6,7-tetramethyl-2,3,4a,6,7,8a-hexahydro-[1,4]dioxino[2,3-b][1,4]dioxine (PubChem CID 544726) has the molecular formula C10H18O4 and a molecular weight of 202.25 g/mol. Its IUPAC name is 2,3,6,7-tetramethyl-2,3,4a,6,7,8a-hexahydro-[1,4]dioxino[2,3-b][1,4]dioxine.
| Compound Name | 2,3,6,7-tetramethyl-2,3,4a,6,7,8a-hexahydro-[1,4]dioxino[2,3-b][1,4]dioxine |
|---|---|
| PubChem CID | 544726 |
| Molecular Formula | C10H18O4 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | 2,3,6,7-tetramethyl-2,3,4a,6,7,8a-hexahydro-[1,4]dioxino[2,3-b][1,4]dioxine |
| SMILES | CC1OC2OC(C)C(C)OC2OC1C |
| InChI | InChI=1S/C10H18O4/c1-5-6(2)12-10-9(11-5)13-7(3)8(4)14-10/h5-10H,1-4H3 |
| InChIKey | RNGOIHXSDODYDF-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |