C8H14O3 — CID 54472729
(4S)-2,2,5,5-tetramethyl-1,3-dioxolane-4-carbaldehyde (PubChem CID 54472729) has the molecular formula C8H14O3 and a molecular weight of 158.20 g/mol. Its IUPAC name is (4S)-2,2,5,5-tetramethyl-1,3-dioxolane-4-carbaldehyde.
| Compound Name | (4S)-2,2,5,5-tetramethyl-1,3-dioxolane-4-carbaldehyde |
|---|---|
| PubChem CID | 54472729 |
| Molecular Formula | C8H14O3 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | (4S)-2,2,5,5-tetramethyl-1,3-dioxolane-4-carbaldehyde |
| SMILES | CC1(C)O[C@H](C=O)C(C)(C)O1 |
| InChI | InChI=1S/C8H14O3/c1-7(2)6(5-9)10-8(3,4)11-7/h5-6H,1-4H3/t6-/m1/s1 |
| InChIKey | XJLDRHDSLAHIFD-ZCFIWIBFSA-N |
| XLogP | 1.12 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|