C12H17ClN2 — CID 54472768
8-chloro-2,4,4-trimethyl-1,3-dihydroisoquinolin-7-amine (PubChem CID 54472768) has the molecular formula C12H17ClN2 and a molecular weight of 224.73 g/mol. Its IUPAC name is 8-chloro-2,4,4-trimethyl-1,3-dihydroisoquinolin-7-amine.
| Compound Name | 8-chloro-2,4,4-trimethyl-1,3-dihydroisoquinolin-7-amine |
|---|---|
| PubChem CID | 54472768 |
| Molecular Formula | C12H17ClN2 |
| Molecular Weight | 224.73 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | 8-chloro-2,4,4-trimethyl-1,3-dihydroisoquinolin-7-amine |
| SMILES | CN1Cc2c(ccc(N)c2Cl)C(C)(C)C1 |
| InChI | InChI=1S/C12H17ClN2/c1-12(2)7-15(3)6-8-9(12)4-5-10(14)11(8)13/h4-5H,6-7,14H2,1-3H3 |
| InChIKey | XJLTZQFGRMHZFL-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.73 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|