C15H25NO9 — CID 54473211
[(2R,3S,5S)-2-acetyloxy-5,6-dihydroxy-1-[(2-methylpropan-2-yl)oxycarbonylamino]-1-oxohexan-3-yl] acetate (PubChem CID 54473211) has the molecular formula C15H25NO9 and a molecular weight of 363.36 g/mol. Its IUPAC name is [(2R,3S,5S)-2-acetyloxy-5,6-dihydroxy-1-[(2-methylpropan-2-yl)oxycarbonylamino]-1-oxohexan-3-yl] acetate.
| Compound Name | [(2R,3S,5S)-2-acetyloxy-5,6-dihydroxy-1-[(2-methylpropan-2-yl)oxycarbonylamino]-1-oxohexan-3-yl] acetate |
|---|---|
| PubChem CID | 54473211 |
| Molecular Formula | C15H25NO9 |
| Molecular Weight | 363.36 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | [(2R,3S,5S)-2-acetyloxy-5,6-dihydroxy-1-[(2-methylpropan-2-yl)oxycarbonylamino]-1-oxohexan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H](C[C@H](O)CO)[C@@H](OC(C)=O)C(=O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H25NO9/c1-8(18)23-11(6-10(20)7-17)12(24-9(2)19)13(21)16-14(22)25-15(3,4)5/h10-12,17,20H,6-7H2,1-5H3,(H,16,21,22)/t10-,11-,12+/m0/s1 |
| InChIKey | XJSQPFDNCTUFEX-SDDRHHMPSA-N |
| XLogP | -0.36 |
| TPSA | 148.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.36 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|