About 2-[(4-butyl-1,2,4-triazol-3-yl)sulfanyl]ethanol
2-[(4-butyl-1,2,4-triazol-3-yl)sulfanyl]ethanol (PubChem CID 54473223) has the molecular formula C8H15N3OS
and a molecular weight of 201.29 g/mol. Its IUPAC name is 2-[(4-butyl-1,2,4-triazol-3-yl)sulfanyl]ethanol.
Molecular Properties
| Compound Name | 2-[(4-butyl-1,2,4-triazol-3-yl)sulfanyl]ethanol |
| PubChem CID | 54473223 |
| Molecular Formula | C8H15N3OS |
| Molecular Weight | 201.29 g/mol |
| Exact Mass | 201.09 |
| IUPAC Name | 2-[(4-butyl-1,2,4-triazol-3-yl)sulfanyl]ethanol |
| SMILES | CCCCn1cnnc1SCCO |
| InChI | InChI=1S/C8H15N3OS/c1-2-3-4-11-7-9-10-8(11)13-6-5-12/h7,12H,2-6H2,1H3 |
| InChIKey | XJSUZDLMXQTOHA-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.29 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(4-butyl-1,2,4-triazol-3-yl)sulfanyl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-butyl-1,2,4-triazol-3-yl)sulfanyl]ethanol?
The IUPAC name of 2-[(4-butyl-1,2,4-triazol-3-yl)sulfanyl]ethanol (CID 54473223) is 2-[(4-butyl-1,2,4-triazol-3-yl)sulfanyl]ethanol.
What is the SMILES notation for 2-[(4-butyl-1,2,4-triazol-3-yl)sulfanyl]ethanol?
The canonical SMILES for 2-[(4-butyl-1,2,4-triazol-3-yl)sulfanyl]ethanol is CCCCn1cnnc1SCCO.
What is the InChIKey of 2-[(4-butyl-1,2,4-triazol-3-yl)sulfanyl]ethanol?
The InChIKey is XJSUZDLMXQTOHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N3OS/c1-2-3-4-11-7-9-10-8(11)13-6-5-12/h7,12H,2-6H2,1H3.
What are the key properties of 2-[(4-butyl-1,2,4-triazol-3-yl)sulfanyl]ethanol?
2-[(4-butyl-1,2,4-triazol-3-yl)sulfanyl]ethanol has a molecular weight of 201.29 g/mol, XLogP of 1.16, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-butyl-1,2,4-triazol-3-yl)sulfanyl]ethanol is sourced from PubChem (CID 54473223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).