C19H23N3O3S — CID 5447347
1-[(Z)-(2,3-dimethoxyphenyl)methylideneamino]-3-[(4-ethoxyphenyl)methyl]thiourea (PubChem CID 5447347) has the molecular formula C19H23N3O3S and a molecular weight of 373.48 g/mol. Its IUPAC name is 1-[(Z)-(2,3-dimethoxyphenyl)methylideneamino]-3-[(4-ethoxyphenyl)methyl]thiourea.
| Compound Name | 1-[(Z)-(2,3-dimethoxyphenyl)methylideneamino]-3-[(4-ethoxyphenyl)methyl]thiourea |
|---|---|
| PubChem CID | 5447347 |
| Molecular Formula | C19H23N3O3S |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | 1-[(Z)-(2,3-dimethoxyphenyl)methylideneamino]-3-[(4-ethoxyphenyl)methyl]thiourea |
| SMILES | CCOc1ccc(CNC(=S)N/N=C\c2cccc(OC)c2OC)cc1 |
| InChI | InChI=1S/C19H23N3O3S/c1-4-25-16-10-8-14(9-11-16)12-20-19(26)22-21-13-15-6-5-7-17(23-2)18(15)24-3/h5-11,13H,4,12H2,1-3H3,(H2,20,22,26)/b21-13- |
| InChIKey | LWORWGSRCICRFC-BKUYFWCQSA-N |
| XLogP | 3.10 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|