C18H23N3O2 — CID 54473685
prop-2-enyl N-[6-(dimethylamino)-6,7,8,9-tetrahydro-5H-carbazol-3-yl]carbamate (PubChem CID 54473685) has the molecular formula C18H23N3O2 and a molecular weight of 313.40 g/mol. Its IUPAC name is prop-2-enyl N-[6-(dimethylamino)-6,7,8,9-tetrahydro-5H-carbazol-3-yl]carbamate.
| Compound Name | prop-2-enyl N-[6-(dimethylamino)-6,7,8,9-tetrahydro-5H-carbazol-3-yl]carbamate |
|---|---|
| PubChem CID | 54473685 |
| Molecular Formula | C18H23N3O2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | prop-2-enyl N-[6-(dimethylamino)-6,7,8,9-tetrahydro-5H-carbazol-3-yl]carbamate |
| SMILES | C=CCOC(=O)Nc1ccc2[nH]c3c(c2c1)CC(N(C)C)CC3 |
| InChI | InChI=1S/C18H23N3O2/c1-4-9-23-18(22)19-12-5-7-16-14(10-12)15-11-13(21(2)3)6-8-17(15)20-16/h4-5,7,10,13,20H,1,6,8-9,11H2,2-3H3,(H,19,22) |
| InChIKey | XKBIWKPMAYSKBI-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|