C19H30NO8P — CID 54474618
methyl (2S)-3-(3-diethoxyphosphoryl-4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 54474618) has the molecular formula C19H30NO8P and a molecular weight of 431.42 g/mol. Its IUPAC name is methyl (2S)-3-(3-diethoxyphosphoryl-4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | methyl (2S)-3-(3-diethoxyphosphoryl-4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 54474618 |
| Molecular Formula | C19H30NO8P |
| Molecular Weight | 431.42 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | methyl (2S)-3-(3-diethoxyphosphoryl-4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | CCOP(=O)(OCC)c1cc(C[C@H](NC(=O)OC(C)(C)C)C(=O)OC)ccc1O |
| InChI | InChI=1S/C19H30NO8P/c1-7-26-29(24,27-8-2)16-12-13(9-10-15(16)21)11-14(17(22)25-6)20-18(23)28-19(3,4)5/h9-10,12,14,21H,7-8,11H2,1-6H3,(H,20,23)/t14-/m0/s1 |
| InChIKey | XKRCHJFLBFYIFY-AWEZNQCLSA-N |
| XLogP | 2.89 |
| TPSA | 120.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.42 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|