C19H16O2 — CID 54474651
4-(1-tetracyclo[6.6.1.02,7.09,14]pentadeca-2,4,6,9,11,13-hexaenyl)but-3-enoic acid (PubChem CID 54474651) has the molecular formula C19H16O2 and a molecular weight of 276.34 g/mol. Its IUPAC name is 4-(1-tetracyclo[6.6.1.02,7.09,14]pentadeca-2,4,6,9,11,13-hexaenyl)but-3-enoic acid.
| Compound Name | 4-(1-tetracyclo[6.6.1.02,7.09,14]pentadeca-2,4,6,9,11,13-hexaenyl)but-3-enoic acid |
|---|---|
| PubChem CID | 54474651 |
| Molecular Formula | C19H16O2 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 4-(1-tetracyclo[6.6.1.02,7.09,14]pentadeca-2,4,6,9,11,13-hexaenyl)but-3-enoic acid |
| SMILES | O=C(O)CC=CC12CC(c3ccccc31)c1ccccc12 |
| InChI | InChI=1S/C19H16O2/c20-18(21)10-5-11-19-12-15(13-6-1-3-8-16(13)19)14-7-2-4-9-17(14)19/h1-9,11,15H,10,12H2,(H,20,21) |
| InChIKey | XKRRWQGCKIRVMW-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|