About 5-methylideneundecane
5-methylideneundecane (PubChem CID 544747) has the molecular formula C12H24
and a molecular weight of 168.32 g/mol. Its IUPAC name is 5-methylideneundecane.
Molecular Properties
| Compound Name | 5-methylideneundecane |
| PubChem CID | 544747 |
| Molecular Formula | C12H24 |
| Molecular Weight | 168.32 g/mol |
| Exact Mass | 168.19 |
| IUPAC Name | 5-methylideneundecane |
| SMILES | C=C(CCCC)CCCCCC |
| InChI | InChI=1S/C12H24/c1-4-6-8-9-11-12(3)10-7-5-2/h3-11H2,1-2H3 |
| InChIKey | MEUHELKJCGXSBF-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.32 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-methylideneundecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylideneundecane?
The IUPAC name of 5-methylideneundecane (CID 544747) is 5-methylideneundecane.
What is the SMILES notation for 5-methylideneundecane?
The canonical SMILES for 5-methylideneundecane is C=C(CCCC)CCCCCC.
What is the InChIKey of 5-methylideneundecane?
The InChIKey is MEUHELKJCGXSBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24/c1-4-6-8-9-11-12(3)10-7-5-2/h3-11H2,1-2H3.
What are the key properties of 5-methylideneundecane?
5-methylideneundecane has a molecular weight of 168.32 g/mol, XLogP of 4.70, 8 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylideneundecane is sourced from PubChem (CID 544747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).