C15H24N8S4 — CID 54474933
1-[2-[[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]methylsulfanyl]ethyl]-3-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]thiourea (PubChem CID 54474933) has the molecular formula C15H24N8S4 and a molecular weight of 444.68 g/mol. Its IUPAC name is 1-[2-[[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]methylsulfanyl]ethyl]-3-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]thiourea.
| Compound Name | 1-[2-[[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]methylsulfanyl]ethyl]-3-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]thiourea |
|---|---|
| PubChem CID | 54474933 |
| Molecular Formula | C15H24N8S4 |
| Molecular Weight | 444.68 g/mol |
| Exact Mass | 444.10 |
| IUPAC Name | 1-[2-[[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]methylsulfanyl]ethyl]-3-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]thiourea |
| SMILES | Cc1[nH]cnc1CSCCNC(=S)NCCSCc1csc(N=C(N)N)n1 |
| InChI | InChI=1S/C15H24N8S4/c1-10-12(21-9-20-10)8-26-5-3-19-14(24)18-2-4-25-6-11-7-27-15(22-11)23-13(16)17/h7,9H,2-6,8H2,1H3,(H,20,21)(H2,18,19,24)(H4,16,17,22,23) |
| InChIKey | XKXDHGCPOBYRDB-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 130.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.68 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imidazole_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|