C22H29N3O2 — CID 54474973
[(6aR,9R)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]methyl piperidine-1-carboxylate (PubChem CID 54474973) has the molecular formula C22H29N3O2 and a molecular weight of 367.49 g/mol. Its IUPAC name is [(6aR,9R)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]methyl piperidine-1-carboxylate.
| Compound Name | [(6aR,9R)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]methyl piperidine-1-carboxylate |
|---|---|
| PubChem CID | 54474973 |
| Molecular Formula | C22H29N3O2 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.23 |
| IUPAC Name | [(6aR,9R)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]methyl piperidine-1-carboxylate |
| SMILES | CN1C[C@H](COC(=O)N2CCCCC2)CC2c3cccc4[nH]cc(c34)C[C@H]21 |
| InChI | InChI=1S/C22H29N3O2/c1-24-13-15(14-27-22(26)25-8-3-2-4-9-25)10-18-17-6-5-7-19-21(17)16(12-23-19)11-20(18)24/h5-7,12,15,18,20,23H,2-4,8-11,13-14H2,1H3/t15-,18?,20-/m1/s1 |
| InChIKey | XKXSHTSFOXNTDO-FBOUHOSPSA-N |
| XLogP | 3.75 |
| TPSA | 48.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |