C26H22F6N2O — CID 54475496
(4aR,10bR)-8-[2,8-bis(trifluoromethyl)quinolin-4-yl]-4,10b-dimethyl-2,4a,5,6-tetrahydro-1H-benzo[f]quinolin-3-one (PubChem CID 54475496) has the molecular formula C26H22F6N2O and a molecular weight of 492.46 g/mol. Its IUPAC name is (4aR,10bR)-8-[2,8-bis(trifluoromethyl)quinolin-4-yl]-4,10b-dimethyl-2,4a,5,6-tetrahydro-1H-benzo[f]quinolin-3-one.
| Compound Name | (4aR,10bR)-8-[2,8-bis(trifluoromethyl)quinolin-4-yl]-4,10b-dimethyl-2,4a,5,6-tetrahydro-1H-benzo[f]quinolin-3-one |
|---|---|
| PubChem CID | 54475496 |
| Molecular Formula | C26H22F6N2O |
| Molecular Weight | 492.46 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | (4aR,10bR)-8-[2,8-bis(trifluoromethyl)quinolin-4-yl]-4,10b-dimethyl-2,4a,5,6-tetrahydro-1H-benzo[f]quinolin-3-one |
| SMILES | CN1C(=O)CC[C@]2(C)c3ccc(-c4cc(C(F)(F)F)nc5c(C(F)(F)F)cccc45)cc3CC[C@@H]12 |
| InChI | InChI=1S/C26H22F6N2O/c1-24-11-10-22(35)34(2)21(24)9-7-15-12-14(6-8-18(15)24)17-13-20(26(30,31)32)33-23-16(17)4-3-5-19(23)25(27,28)29/h3-6,8,12-13,21H,7,9-11H2,1-2H3/t21-,24-/m1/s1 |
| InChIKey | XLGYHJSLLSBWNE-ZJSXRUAMSA-N |
| XLogP | 6.76 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.46 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |