C3H12NO9P3 — CID 54475795
[aminomethyl(phosphonomethoxy)phosphoryl]oxymethylphosphonic acid (PubChem CID 54475795) has the molecular formula C3H12NO9P3 and a molecular weight of 299.05 g/mol. Its IUPAC name is [aminomethyl(phosphonomethoxy)phosphoryl]oxymethylphosphonic acid.
| Compound Name | [aminomethyl(phosphonomethoxy)phosphoryl]oxymethylphosphonic acid |
|---|---|
| PubChem CID | 54475795 |
| Molecular Formula | C3H12NO9P3 |
| Molecular Weight | 299.05 g/mol |
| Exact Mass | 298.97 |
| IUPAC Name | [aminomethyl(phosphonomethoxy)phosphoryl]oxymethylphosphonic acid |
| SMILES | NCP(=O)(OCP(=O)(O)O)OCP(=O)(O)O |
| InChI | InChI=1S/C3H12NO9P3/c4-1-16(11,12-2-14(5,6)7)13-3-15(8,9)10/h1-4H2,(H2,5,6,7)(H2,8,9,10) |
| InChIKey | XLMHVLLQSBBIQT-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 176.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.05 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|