C6H8F2O — CID 54476084
6-(difluoromethyl)-3,4-dihydro-2H-pyran (PubChem CID 54476084) has the molecular formula C6H8F2O and a molecular weight of 134.12 g/mol. Its IUPAC name is 6-(difluoromethyl)-3,4-dihydro-2H-pyran.
| Compound Name | 6-(difluoromethyl)-3,4-dihydro-2H-pyran |
|---|---|
| PubChem CID | 54476084 |
| Molecular Formula | C6H8F2O |
| Molecular Weight | 134.12 g/mol |
| Exact Mass | 134.05 |
| IUPAC Name | 6-(difluoromethyl)-3,4-dihydro-2H-pyran |
| SMILES | FC(F)C1=CCCCO1 |
| InChI | InChI=1S/C6H8F2O/c7-6(8)5-3-1-2-4-9-5/h3,6H,1-2,4H2 |
| InChIKey | UTKWAXHNJDQOTN-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.12 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |