About 6-(difluoromethyl)-3,4-dihydro-2H-pyran
6-(difluoromethyl)-3,4-dihydro-2H-pyran (PubChem CID 54476084) has the molecular formula C6H8F2O
and a molecular weight of 134.12 g/mol. Its IUPAC name is 6-(difluoromethyl)-3,4-dihydro-2H-pyran.
Molecular Properties
| Compound Name | 6-(difluoromethyl)-3,4-dihydro-2H-pyran |
| PubChem CID | 54476084 |
| Molecular Formula | C6H8F2O |
| Molecular Weight | 134.12 g/mol |
| Exact Mass | 134.05 |
| IUPAC Name | 6-(difluoromethyl)-3,4-dihydro-2H-pyran |
| SMILES | FC(F)C1=CCCCO1 |
| InChI | InChI=1S/C6H8F2O/c7-6(8)5-3-1-2-4-9-5/h3,6H,1-2,4H2 |
| InChIKey | UTKWAXHNJDQOTN-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.12 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-(difluoromethyl)-3,4-dihydro-2H-pyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(difluoromethyl)-3,4-dihydro-2H-pyran?
The IUPAC name of 6-(difluoromethyl)-3,4-dihydro-2H-pyran (CID 54476084) is 6-(difluoromethyl)-3,4-dihydro-2H-pyran.
What is the SMILES notation for 6-(difluoromethyl)-3,4-dihydro-2H-pyran?
The canonical SMILES for 6-(difluoromethyl)-3,4-dihydro-2H-pyran is FC(F)C1=CCCCO1.
What is the InChIKey of 6-(difluoromethyl)-3,4-dihydro-2H-pyran?
The InChIKey is UTKWAXHNJDQOTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8F2O/c7-6(8)5-3-1-2-4-9-5/h3,6H,1-2,4H2.
What are the key properties of 6-(difluoromethyl)-3,4-dihydro-2H-pyran?
6-(difluoromethyl)-3,4-dihydro-2H-pyran has a molecular weight of 134.12 g/mol, XLogP of 1.95, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(difluoromethyl)-3,4-dihydro-2H-pyran is sourced from PubChem (CID 54476084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).