C23H32N4O5 — CID 54476658
4-[2-(5-octyl-2,4,6-trioxo-1,3-diazinan-5-yl)piperazin-1-yl]benzoic acid (PubChem CID 54476658) has the molecular formula C23H32N4O5 and a molecular weight of 444.53 g/mol. Its IUPAC name is 4-[2-(5-octyl-2,4,6-trioxo-1,3-diazinan-5-yl)piperazin-1-yl]benzoic acid.
| Compound Name | 4-[2-(5-octyl-2,4,6-trioxo-1,3-diazinan-5-yl)piperazin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 54476658 |
| Molecular Formula | C23H32N4O5 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.24 |
| IUPAC Name | 4-[2-(5-octyl-2,4,6-trioxo-1,3-diazinan-5-yl)piperazin-1-yl]benzoic acid |
| SMILES | CCCCCCCCC1(C2CNCCN2c2ccc(C(=O)O)cc2)C(=O)NC(=O)NC1=O |
| InChI | InChI=1S/C23H32N4O5/c1-2-3-4-5-6-7-12-23(20(30)25-22(32)26-21(23)31)18-15-24-13-14-27(18)17-10-8-16(9-11-17)19(28)29/h8-11,18,24H,2-7,12-15H2,1H3,(H,28,29)(H2,25,26,30,31,32) |
| InChIKey | XMBDNFFMSLWUED-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 127.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|