About dimethyl 5,6-bis(5-methoxypent-1-ynyl)pyrazine-2,3-dicarboxylate
dimethyl 5,6-bis(5-methoxypent-1-ynyl)pyrazine-2,3-dicarboxylate (PubChem CID 54476719) has the molecular formula C20H24N2O6
and a molecular weight of 388.42 g/mol. Its IUPAC name is dimethyl 5,6-bis(5-methoxypent-1-ynyl)pyrazine-2,3-dicarboxylate.
Molecular Properties
| Compound Name | dimethyl 5,6-bis(5-methoxypent-1-ynyl)pyrazine-2,3-dicarboxylate |
| PubChem CID | 54476719 |
| Molecular Formula | C20H24N2O6 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | dimethyl 5,6-bis(5-methoxypent-1-ynyl)pyrazine-2,3-dicarboxylate |
| SMILES | COCCCC#Cc1nc(C(=O)OC)c(C(=O)OC)nc1C#CCCCOC |
| InChI | InChI=1S/C20H24N2O6/c1-25-13-9-5-7-11-15-16(12-8-6-10-14-26-2)22-18(20(24)28-4)17(21-15)19(23)27-3/h5-6,9-10,13-14H2,1-4H3 |
| InChIKey | XMCIJWIIDUMPOM-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 96.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze dimethyl 5,6-bis(5-methoxypent-1-ynyl)pyrazine-2,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 5,6-bis(5-methoxypent-1-ynyl)pyrazine-2,3-dicarboxylate?
The IUPAC name of dimethyl 5,6-bis(5-methoxypent-1-ynyl)pyrazine-2,3-dicarboxylate (CID 54476719) is dimethyl 5,6-bis(5-methoxypent-1-ynyl)pyrazine-2,3-dicarboxylate.
What is the SMILES notation for dimethyl 5,6-bis(5-methoxypent-1-ynyl)pyrazine-2,3-dicarboxylate?
The canonical SMILES for dimethyl 5,6-bis(5-methoxypent-1-ynyl)pyrazine-2,3-dicarboxylate is COCCCC#Cc1nc(C(=O)OC)c(C(=O)OC)nc1C#CCCCOC.
What is the InChIKey of dimethyl 5,6-bis(5-methoxypent-1-ynyl)pyrazine-2,3-dicarboxylate?
The InChIKey is XMCIJWIIDUMPOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24N2O6/c1-25-13-9-5-7-11-15-16(12-8-6-10-14-26-2)22-18(20(24)28-4)17(21-15)19(23)27-3/h5-6,9-10,13-14H2,1-4H3.
What are the key properties of dimethyl 5,6-bis(5-methoxypent-1-ynyl)pyrazine-2,3-dicarboxylate?
dimethyl 5,6-bis(5-methoxypent-1-ynyl)pyrazine-2,3-dicarboxylate has a molecular weight of 388.42 g/mol, XLogP of 1.61, 8 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 5,6-bis(5-methoxypent-1-ynyl)pyrazine-2,3-dicarboxylate is sourced from PubChem (CID 54476719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).