C20H39NO — CID 54476832
2,2,6,6-tetramethyl-1-undec-10-enylpiperidin-4-ol (PubChem CID 54476832) has the molecular formula C20H39NO and a molecular weight of 309.54 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-1-undec-10-enylpiperidin-4-ol.
| Compound Name | 2,2,6,6-tetramethyl-1-undec-10-enylpiperidin-4-ol |
|---|---|
| PubChem CID | 54476832 |
| Molecular Formula | C20H39NO |
| Molecular Weight | 309.54 g/mol |
| Exact Mass | 309.30 |
| IUPAC Name | 2,2,6,6-tetramethyl-1-undec-10-enylpiperidin-4-ol |
| SMILES | C=CCCCCCCCCCN1C(C)(C)CC(O)CC1(C)C |
| InChI | InChI=1S/C20H39NO/c1-6-7-8-9-10-11-12-13-14-15-21-19(2,3)16-18(22)17-20(21,4)5/h6,18,22H,1,7-17H2,2-5H3 |
| InChIKey | XMEHTGOPVNPKIM-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.54 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|