C16H4I2O6 — CID 54476878
2,10-diiodo-6,15-dioxatetracyclo[9.7.0.04,17.08,13]octadeca-1(18),2,4(17),8(13),9,11-hexaene-5,7,14,16-tetrone (PubChem CID 54476878) has the molecular formula C16H4I2O6 and a molecular weight of 546.01 g/mol. Its IUPAC name is 2,10-diiodo-6,15-dioxatetracyclo[9.7.0.04,17.08,13]octadeca-1(18),2,4(17),8(13),9,11-hexaene-5,7,14,16-tetrone.
| Compound Name | 2,10-diiodo-6,15-dioxatetracyclo[9.7.0.04,17.08,13]octadeca-1(18),2,4(17),8(13),9,11-hexaene-5,7,14,16-tetrone |
|---|---|
| PubChem CID | 54476878 |
| Molecular Formula | C16H4I2O6 |
| Molecular Weight | 546.01 g/mol |
| Exact Mass | 545.81 |
| IUPAC Name | 2,10-diiodo-6,15-dioxatetracyclo[9.7.0.04,17.08,13]octadeca-1(18),2,4(17),8(13),9,11-hexaene-5,7,14,16-tetrone |
| SMILES | O=C1OC(=O)c2cc(I)c3cc2C(=O)OC(=O)c2cc-3c(I)cc21 |
| InChI | InChI=1S/C16H4I2O6/c17-11-3-9-7-1-5(11)6-2-8(14(20)23-13(7)19)10(4-12(6)18)16(22)24-15(9)21/h1-4H |
| InChIKey | XMFGEKQYLDXEDY-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.01 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|