C14H16INO3 — CID 54477128
4-benzyl-6-hydroxy-2-(iodomethyl)-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]pyrrol-5-one (PubChem CID 54477128) has the molecular formula C14H16INO3 and a molecular weight of 373.19 g/mol. Its IUPAC name is 4-benzyl-6-hydroxy-2-(iodomethyl)-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]pyrrol-5-one.
| Compound Name | 4-benzyl-6-hydroxy-2-(iodomethyl)-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]pyrrol-5-one |
|---|---|
| PubChem CID | 54477128 |
| Molecular Formula | C14H16INO3 |
| Molecular Weight | 373.19 g/mol |
| Exact Mass | 373.02 |
| IUPAC Name | 4-benzyl-6-hydroxy-2-(iodomethyl)-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]pyrrol-5-one |
| SMILES | O=C1C(O)C2OC(CI)CC2N1Cc1ccccc1 |
| InChI | InChI=1S/C14H16INO3/c15-7-10-6-11-13(19-10)12(17)14(18)16(11)8-9-4-2-1-3-5-9/h1-5,10-13,17H,6-8H2 |
| InChIKey | XMJJBJDLLLUONN-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.19 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|