C10H6Cl6O2 — CID 54477452
3-(1,4,5,6,7,7-hexachloro-2-bicyclo[2.2.1]hept-5-enyl)prop-2-enoic acid (PubChem CID 54477452) has the molecular formula C10H6Cl6O2 and a molecular weight of 370.87 g/mol. Its IUPAC name is 3-(1,4,5,6,7,7-hexachloro-2-bicyclo[2.2.1]hept-5-enyl)prop-2-enoic acid.
| Compound Name | 3-(1,4,5,6,7,7-hexachloro-2-bicyclo[2.2.1]hept-5-enyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 54477452 |
| Molecular Formula | C10H6Cl6O2 |
| Molecular Weight | 370.87 g/mol |
| Exact Mass | 367.85 |
| IUPAC Name | 3-(1,4,5,6,7,7-hexachloro-2-bicyclo[2.2.1]hept-5-enyl)prop-2-enoic acid |
| SMILES | O=C(O)C=CC1CC2(Cl)C(Cl)=C(Cl)C1(Cl)C2(Cl)Cl |
| InChI | InChI=1S/C10H6Cl6O2/c11-6-7(12)9(14)4(1-2-5(17)18)3-8(6,13)10(9,15)16/h1-2,4H,3H2,(H,17,18) |
| InChIKey | XMPBOPWPYZXMMJ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.87 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|