About 4-ethoxy-N,N,5-trimethylthiophene-2-sulfonamide
4-ethoxy-N,N,5-trimethylthiophene-2-sulfonamide (PubChem CID 54477607) has the molecular formula C9H15NO3S2
and a molecular weight of 249.36 g/mol. Its IUPAC name is 4-ethoxy-N,N,5-trimethylthiophene-2-sulfonamide.
Molecular Properties
| Compound Name | 4-ethoxy-N,N,5-trimethylthiophene-2-sulfonamide |
| PubChem CID | 54477607 |
| Molecular Formula | C9H15NO3S2 |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.05 |
| IUPAC Name | 4-ethoxy-N,N,5-trimethylthiophene-2-sulfonamide |
| SMILES | CCOc1cc(S(=O)(=O)N(C)C)sc1C |
| InChI | InChI=1S/C9H15NO3S2/c1-5-13-8-6-9(14-7(8)2)15(11,12)10(3)4/h6H,5H2,1-4H3 |
| InChIKey | XMRQQYOEKQZODW-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-ethoxy-N,N,5-trimethylthiophene-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethoxy-N,N,5-trimethylthiophene-2-sulfonamide?
The IUPAC name of 4-ethoxy-N,N,5-trimethylthiophene-2-sulfonamide (CID 54477607) is 4-ethoxy-N,N,5-trimethylthiophene-2-sulfonamide.
What is the SMILES notation for 4-ethoxy-N,N,5-trimethylthiophene-2-sulfonamide?
The canonical SMILES for 4-ethoxy-N,N,5-trimethylthiophene-2-sulfonamide is CCOc1cc(S(=O)(=O)N(C)C)sc1C.
What is the InChIKey of 4-ethoxy-N,N,5-trimethylthiophene-2-sulfonamide?
The InChIKey is XMRQQYOEKQZODW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO3S2/c1-5-13-8-6-9(14-7(8)2)15(11,12)10(3)4/h6H,5H2,1-4H3.
What are the key properties of 4-ethoxy-N,N,5-trimethylthiophene-2-sulfonamide?
4-ethoxy-N,N,5-trimethylthiophene-2-sulfonamide has a molecular weight of 249.36 g/mol, XLogP of 1.71, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethoxy-N,N,5-trimethylthiophene-2-sulfonamide is sourced from PubChem (CID 54477607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).