C27H45FO2 — CID 54478239
(8S,9S,10R,13S,14S,17R)-3-fluoro-17-[(2S)-3-hydroxy-6-methylheptan-2-yl]-10,13-dimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 54478239) has the molecular formula C27H45FO2 and a molecular weight of 420.65 g/mol. Its IUPAC name is (8S,9S,10R,13S,14S,17R)-3-fluoro-17-[(2S)-3-hydroxy-6-methylheptan-2-yl]-10,13-dimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (8S,9S,10R,13S,14S,17R)-3-fluoro-17-[(2S)-3-hydroxy-6-methylheptan-2-yl]-10,13-dimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 54478239 |
| Molecular Formula | C27H45FO2 |
| Molecular Weight | 420.65 g/mol |
| Exact Mass | 420.34 |
| IUPAC Name | (8S,9S,10R,13S,14S,17R)-3-fluoro-17-[(2S)-3-hydroxy-6-methylheptan-2-yl]-10,13-dimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | CC(C)CCC(O)[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4CC(O)(F)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C27H45FO2/c1-17(2)6-11-24(29)18(3)21-9-10-22-20-8-7-19-16-27(28,30)15-14-25(19,4)23(20)12-13-26(21,22)5/h7,17-18,20-24,29-30H,6,8-16H2,1-5H3/t18-,20-,21+,22-,23-,24?,25-,26+,27?/m0/s1 |
| InChIKey | XNCSTUVQPZAGJF-LZCQQLPWSA-N |
| XLogP | 6.66 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.65 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|