C31H44N2O5S2 — CID 54478419
[[4-[[(1-cyclohexyl-3-ethylsulfanylpropan-2-yl)amino]methyl]-2-(2-methylphenyl)benzoyl]amino] 4-methylsulfonylbutanoate (PubChem CID 54478419) has the molecular formula C31H44N2O5S2 and a molecular weight of 588.84 g/mol. Its IUPAC name is [[4-[[(1-cyclohexyl-3-ethylsulfanylpropan-2-yl)amino]methyl]-2-(2-methylphenyl)benzoyl]amino] 4-methylsulfonylbutanoate.
| Compound Name | [[4-[[(1-cyclohexyl-3-ethylsulfanylpropan-2-yl)amino]methyl]-2-(2-methylphenyl)benzoyl]amino] 4-methylsulfonylbutanoate |
|---|---|
| PubChem CID | 54478419 |
| Molecular Formula | C31H44N2O5S2 |
| Molecular Weight | 588.84 g/mol |
| Exact Mass | 588.27 |
| IUPAC Name | [[4-[[(1-cyclohexyl-3-ethylsulfanylpropan-2-yl)amino]methyl]-2-(2-methylphenyl)benzoyl]amino] 4-methylsulfonylbutanoate |
| SMILES | CCSCC(CC1CCCCC1)NCc1ccc(C(=O)NOC(=O)CCCS(C)(=O)=O)c(-c2ccccc2C)c1 |
| InChI | InChI=1S/C31H44N2O5S2/c1-4-39-22-26(19-24-12-6-5-7-13-24)32-21-25-16-17-28(29(20-25)27-14-9-8-11-23(27)2)31(35)33-38-30(34)15-10-18-40(3,36)37/h8-9,11,14,16-17,20,24,26,32H,4-7,10,12-13,15,18-19,21-22H2,1-3H3,(H,33,35) |
| InChIKey | XNGGWFAREBAVTG-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.84 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|