About tert-butyl [2,6-dimethyl-4-[(1-phenylpyrazol-3-yl)amino]phenyl] carbonate
tert-butyl [2,6-dimethyl-4-[(1-phenylpyrazol-3-yl)amino]phenyl] carbonate (PubChem CID 54478664) has the molecular formula C22H25N3O3
and a molecular weight of 379.46 g/mol. Its IUPAC name is tert-butyl [2,6-dimethyl-4-[(1-phenylpyrazol-3-yl)amino]phenyl] carbonate.
Molecular Properties
| Compound Name | tert-butyl [2,6-dimethyl-4-[(1-phenylpyrazol-3-yl)amino]phenyl] carbonate |
| PubChem CID | 54478664 |
| Molecular Formula | C22H25N3O3 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | tert-butyl [2,6-dimethyl-4-[(1-phenylpyrazol-3-yl)amino]phenyl] carbonate |
| SMILES | Cc1cc(Nc2ccn(-c3ccccc3)n2)cc(C)c1OC(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H25N3O3/c1-15-13-17(14-16(2)20(15)27-21(26)28-22(3,4)5)23-19-11-12-25(24-19)18-9-7-6-8-10-18/h6-14H,1-5H3,(H,23,24) |
| InChIKey | XNKVDJRYVFSFMM-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl [2,6-dimethyl-4-[(1-phenylpyrazol-3-yl)amino]phenyl] carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl [2,6-dimethyl-4-[(1-phenylpyrazol-3-yl)amino]phenyl] carbonate?
The IUPAC name of tert-butyl [2,6-dimethyl-4-[(1-phenylpyrazol-3-yl)amino]phenyl] carbonate (CID 54478664) is tert-butyl [2,6-dimethyl-4-[(1-phenylpyrazol-3-yl)amino]phenyl] carbonate.
What is the SMILES notation for tert-butyl [2,6-dimethyl-4-[(1-phenylpyrazol-3-yl)amino]phenyl] carbonate?
The canonical SMILES for tert-butyl [2,6-dimethyl-4-[(1-phenylpyrazol-3-yl)amino]phenyl] carbonate is Cc1cc(Nc2ccn(-c3ccccc3)n2)cc(C)c1OC(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl [2,6-dimethyl-4-[(1-phenylpyrazol-3-yl)amino]phenyl] carbonate?
The InChIKey is XNKVDJRYVFSFMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25N3O3/c1-15-13-17(14-16(2)20(15)27-21(26)28-22(3,4)5)23-19-11-12-25(24-19)18-9-7-6-8-10-18/h6-14H,1-5H3,(H,23,24).
What are the key properties of tert-butyl [2,6-dimethyl-4-[(1-phenylpyrazol-3-yl)amino]phenyl] carbonate?
tert-butyl [2,6-dimethyl-4-[(1-phenylpyrazol-3-yl)amino]phenyl] carbonate has a molecular weight of 379.46 g/mol, XLogP of 5.55, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl [2,6-dimethyl-4-[(1-phenylpyrazol-3-yl)amino]phenyl] carbonate is sourced from PubChem (CID 54478664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).