About 2-aminopent-3-en-1-ol
2-aminopent-3-en-1-ol (PubChem CID 54479104) has the molecular formula C5H11NO
and a molecular weight of 101.15 g/mol. Its IUPAC name is 2-aminopent-3-en-1-ol.
Molecular Properties
| Compound Name | 2-aminopent-3-en-1-ol |
| PubChem CID | 54479104 |
| Molecular Formula | C5H11NO |
| Molecular Weight | 101.15 g/mol |
| Exact Mass | 101.08 |
| IUPAC Name | 2-aminopent-3-en-1-ol |
| SMILES | CC=CC(N)CO |
| InChI | InChI=1S/C5H11NO/c1-2-3-5(6)4-7/h2-3,5,7H,4,6H2,1H3 |
| InChIKey | NDPPRLUZHXMLMB-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 101.15 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-aminopent-3-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminopent-3-en-1-ol?
The IUPAC name of 2-aminopent-3-en-1-ol (CID 54479104) is 2-aminopent-3-en-1-ol.
What is the SMILES notation for 2-aminopent-3-en-1-ol?
The canonical SMILES for 2-aminopent-3-en-1-ol is CC=CC(N)CO.
What is the InChIKey of 2-aminopent-3-en-1-ol?
The InChIKey is NDPPRLUZHXMLMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO/c1-2-3-5(6)4-7/h2-3,5,7H,4,6H2,1H3.
What are the key properties of 2-aminopent-3-en-1-ol?
2-aminopent-3-en-1-ol has a molecular weight of 101.15 g/mol, XLogP of -0.12, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminopent-3-en-1-ol is sourced from PubChem (CID 54479104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).