About 3-chloro-4-[(4,5-dichlorodithiol-3-ylidene)amino]-N,N-dimethylbenzamide
3-chloro-4-[(4,5-dichlorodithiol-3-ylidene)amino]-N,N-dimethylbenzamide (PubChem CID 54479285) has the molecular formula C12H9Cl3N2OS2
and a molecular weight of 367.71 g/mol. Its IUPAC name is 3-chloro-4-[(4,5-dichlorodithiol-3-ylidene)amino]-N,N-dimethylbenzamide.
Molecular Properties
| Compound Name | 3-chloro-4-[(4,5-dichlorodithiol-3-ylidene)amino]-N,N-dimethylbenzamide |
| PubChem CID | 54479285 |
| Molecular Formula | C12H9Cl3N2OS2 |
| Molecular Weight | 367.71 g/mol |
| Exact Mass | 365.92 |
| IUPAC Name | 3-chloro-4-[(4,5-dichlorodithiol-3-ylidene)amino]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccc(/N=c2/ssc(Cl)c2Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H9Cl3N2OS2/c1-17(2)12(18)6-3-4-8(7(13)5-6)16-11-9(14)10(15)19-20-11/h3-5H,1-2H3/b16-11+ |
| InChIKey | XNVSHQKIDAUQSB-LFIBNONCSA-N |
| XLogP | 4.70 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.71 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-chloro-4-[(4,5-dichlorodithiol-3-ylidene)amino]-N,N-dimethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-4-[(4,5-dichlorodithiol-3-ylidene)amino]-N,N-dimethylbenzamide?
The IUPAC name of 3-chloro-4-[(4,5-dichlorodithiol-3-ylidene)amino]-N,N-dimethylbenzamide (CID 54479285) is 3-chloro-4-[(4,5-dichlorodithiol-3-ylidene)amino]-N,N-dimethylbenzamide.
What is the SMILES notation for 3-chloro-4-[(4,5-dichlorodithiol-3-ylidene)amino]-N,N-dimethylbenzamide?
The canonical SMILES for 3-chloro-4-[(4,5-dichlorodithiol-3-ylidene)amino]-N,N-dimethylbenzamide is CN(C)C(=O)c1ccc(/N=c2/ssc(Cl)c2Cl)c(Cl)c1.
What is the InChIKey of 3-chloro-4-[(4,5-dichlorodithiol-3-ylidene)amino]-N,N-dimethylbenzamide?
The InChIKey is XNVSHQKIDAUQSB-LFIBNONCSA-N. The full InChI is InChI=1S/C12H9Cl3N2OS2/c1-17(2)12(18)6-3-4-8(7(13)5-6)16-11-9(14)10(15)19-20-11/h3-5H,1-2H3/b16-11+.
What are the key properties of 3-chloro-4-[(4,5-dichlorodithiol-3-ylidene)amino]-N,N-dimethylbenzamide?
3-chloro-4-[(4,5-dichlorodithiol-3-ylidene)amino]-N,N-dimethylbenzamide has a molecular weight of 367.71 g/mol, XLogP of 4.70, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-4-[(4,5-dichlorodithiol-3-ylidene)amino]-N,N-dimethylbenzamide is sourced from PubChem (CID 54479285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).