About N-methylpropan-2-imine;bis(N,N,N'-trimethylethanimidamide)
N-methylpropan-2-imine;bis(N,N,N'-trimethylethanimidamide) (PubChem CID 54479690) has the molecular formula C14H33N5
and a molecular weight of 271.45 g/mol. Its IUPAC name is N-methylpropan-2-imine;bis(N,N,N'-trimethylethanimidamide).
Molecular Properties
| Compound Name | N-methylpropan-2-imine;bis(N,N,N'-trimethylethanimidamide) |
| PubChem CID | 54479690 |
| Molecular Formula | C14H33N5 |
| Molecular Weight | 271.45 g/mol |
| Exact Mass | 271.27 |
| IUPAC Name | N-methylpropan-2-imine;bis(N,N,N'-trimethylethanimidamide) |
| SMILES | C/N=C(\C)N(C)C.C/N=C(\C)N(C)C.CN=C(C)C |
| InChI | InChI=1S/2C5H12N2.C4H9N/c2*1-5(6-2)7(3)4;1-4(2)5-3/h2*1-4H3;1-3H3/b2*6-5+; |
| InChIKey | XODDWCGMVLMYRC-PJJNIZFLSA-N |
| XLogP | 2.29 |
| TPSA | 43.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.45 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-methylpropan-2-imine;bis(N,N,N'-trimethylethanimidamide) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylpropan-2-imine;bis(N,N,N'-trimethylethanimidamide)?
The IUPAC name of N-methylpropan-2-imine;bis(N,N,N'-trimethylethanimidamide) (CID 54479690) is N-methylpropan-2-imine;bis(N,N,N'-trimethylethanimidamide).
What is the SMILES notation for N-methylpropan-2-imine;bis(N,N,N'-trimethylethanimidamide)?
The canonical SMILES for N-methylpropan-2-imine;bis(N,N,N'-trimethylethanimidamide) is C/N=C(\C)N(C)C.C/N=C(\C)N(C)C.CN=C(C)C.
What is the InChIKey of N-methylpropan-2-imine;bis(N,N,N'-trimethylethanimidamide)?
The InChIKey is XODDWCGMVLMYRC-PJJNIZFLSA-N. The full InChI is InChI=1S/2C5H12N2.C4H9N/c2*1-5(6-2)7(3)4;1-4(2)5-3/h2*1-4H3;1-3H3/b2*6-5+;.
What are the key properties of N-methylpropan-2-imine;bis(N,N,N'-trimethylethanimidamide)?
N-methylpropan-2-imine;bis(N,N,N'-trimethylethanimidamide) has a molecular weight of 271.45 g/mol, XLogP of 2.29, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylpropan-2-imine;bis(N,N,N'-trimethylethanimidamide) is sourced from PubChem (CID 54479690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).